C9H12BrNO2S — CID 61395355
ethyl N-[(5-bromothiophen-3-yl)methyl]-N-methylcarbamate (PubChem CID 61395355) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is ethyl N-[(5-bromothiophen-3-yl)methyl]-N-methylcarbamate.
| Compound Name | ethyl N-[(5-bromothiophen-3-yl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 61395355 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | ethyl N-[(5-bromothiophen-3-yl)methyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C9H12BrNO2S/c1-3-13-9(12)11(2)5-7-4-8(10)14-6-7/h4,6H,3,5H2,1-2H3 |
| InChIKey | RWBQMQSHQLGPQG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |