C11H16BrNOS — CID 61394474
N-[(5-bromothiophen-3-yl)methyl]-N,2-dimethylbutanamide (PubChem CID 61394474) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N,2-dimethylbutanamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 61394474 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N,2-dimethylbutanamide |
| SMILES | CCC(C)C(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C11H16BrNOS/c1-4-8(2)11(14)13(3)6-9-5-10(12)15-7-9/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | KENHBHDQZULHBW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |