C10H14BrNOS — CID 61394592
N-[(5-bromothiophen-3-yl)methyl]-N-methylbutanamide (PubChem CID 61394592) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methylbutanamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 61394592 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C10H14BrNOS/c1-3-4-10(13)12(2)6-8-5-9(11)14-7-8/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | JRRWSNKPVXOFKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |