C14H15BrN2O2S2 — CID 86839463
N-[3-[(5-bromothiophen-3-yl)methyl-methylamino]-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 86839463) has the molecular formula C14H15BrN2O2S2 and a molecular weight of 387.32 g/mol. Its IUPAC name is N-[3-[(5-bromothiophen-3-yl)methyl-methylamino]-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(5-bromothiophen-3-yl)methyl-methylamino]-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86839463 |
| Molecular Formula | C14H15BrN2O2S2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | N-[3-[(5-bromothiophen-3-yl)methyl-methylamino]-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H15BrN2O2S2/c1-17(8-10-7-12(15)21-9-10)13(18)4-5-16-14(19)11-3-2-6-20-11/h2-3,6-7,9H,4-5,8H2,1H3,(H,16,19) |
| InChIKey | PMEOSMLZJFRTQE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |