C19H22N2O4S — CID 78794285
N-[4-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 78794285) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[4-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78794285 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[4-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1ccc2c(c1)OCCO2)C(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H22N2O4S/c1-21(13-14-6-7-15-16(12-14)25-10-9-24-15)18(22)5-2-8-20-19(23)17-4-3-11-26-17/h3-4,6-7,11-12H,2,5,8-10,13H2,1H3,(H,20,23) |
| InChIKey | GGXNRYKJLVLFRL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|