C13H12Br2N2O3S — CID 75467426
5-bromo-N-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 75467426) has the molecular formula C13H12Br2N2O3S and a molecular weight of 436.13 g/mol. Its IUPAC name is 5-bromo-N-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 75467426 |
| Molecular Formula | C13H12Br2N2O3S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 5-bromo-N-[2-[(5-bromothiophen-3-yl)methyl-methylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H12Br2N2O3S/c1-17(6-8-4-11(15)21-7-8)12(18)5-16-13(19)9-2-3-10(14)20-9/h2-4,7H,5-6H2,1H3,(H,16,19) |
| InChIKey | XPCLDSJKPFHWTG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |