C14H14BrNOS2 — CID 107025972
N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-(4-sulfanylphenyl)acetamide (PubChem CID 107025972) has the molecular formula C14H14BrNOS2 and a molecular weight of 356.31 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107025972 |
| Molecular Formula | C14H14BrNOS2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-(4-sulfanylphenyl)acetamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)Cc1ccc(S)cc1 |
| InChI | InChI=1S/C14H14BrNOS2/c1-16(8-11-6-13(15)19-9-11)14(17)7-10-2-4-12(18)5-3-10/h2-6,9,18H,7-8H2,1H3 |
| InChIKey | GDHMFKHIEOKBLH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|