C13H11BrClNOS2 — CID 107025971
N-[(5-bromothiophen-3-yl)methyl]-2-chloro-N-methyl-5-sulfanylbenzamide (PubChem CID 107025971) has the molecular formula C13H11BrClNOS2 and a molecular weight of 376.73 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-chloro-N-methyl-5-sulfanylbenzamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-chloro-N-methyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107025971 |
| Molecular Formula | C13H11BrClNOS2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-chloro-N-methyl-5-sulfanylbenzamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C13H11BrClNOS2/c1-16(6-8-4-12(14)19-7-8)13(17)10-5-9(18)2-3-11(10)15/h2-5,7,18H,6H2,1H3 |
| InChIKey | BBPUXBQRMVIEBJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|