C14H13BrClNOS — CID 82883457
N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N,2-dimethylbenzamide (PubChem CID 82883457) has the molecular formula C14H13BrClNOS and a molecular weight of 358.69 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N,2-dimethylbenzamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 82883457 |
| Molecular Formula | C14H13BrClNOS |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(Cl)cc1C(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C14H13BrClNOS/c1-9-3-4-11(16)6-12(9)14(18)17(2)7-10-5-13(15)19-8-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | IEGSTQMXBWATCE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |