C14H13BrN2O3S — CID 61409828
N-[(5-bromothiophen-3-yl)methyl]-N,3-dimethyl-2-nitrobenzamide (PubChem CID 61409828) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N,3-dimethyl-2-nitrobenzamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N,3-dimethyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 61409828 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N,3-dimethyl-2-nitrobenzamide |
| SMILES | Cc1cccc(C(=O)N(C)Cc2csc(Br)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13BrN2O3S/c1-9-4-3-5-11(13(9)17(19)20)14(18)16(2)7-10-6-12(15)21-8-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | OIXHLQCYUSQCEP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|