C12H15BrN2O3 — CID 106441083
N-(3-bromopropyl)-N,3-dimethyl-2-nitrobenzamide (PubChem CID 106441083) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N-(3-bromopropyl)-N,3-dimethyl-2-nitrobenzamide.
| Compound Name | N-(3-bromopropyl)-N,3-dimethyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 106441083 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-(3-bromopropyl)-N,3-dimethyl-2-nitrobenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CCCBr)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15BrN2O3/c1-9-5-3-6-10(11(9)15(17)18)12(16)14(2)8-4-7-13/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | JJKSPTTUZJLSCP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|