C13H17BrN2O4 — CID 80671007
N-(2-bromo-3-methoxypropyl)-N,3-dimethyl-2-nitrobenzamide (PubChem CID 80671007) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N,3-dimethyl-2-nitrobenzamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-N,3-dimethyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 80671007 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N,3-dimethyl-2-nitrobenzamide |
| SMILES | COCC(Br)CN(C)C(=O)c1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BrN2O4/c1-9-5-4-6-11(12(9)16(18)19)13(17)15(2)7-10(14)8-20-3/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | PUWLJJHGGQCHDW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|