C13H17BrFNO2 — CID 80671755
N-(2-bromo-3-methoxypropyl)-2-fluoro-N,5-dimethylbenzamide (PubChem CID 80671755) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-2-fluoro-N,5-dimethylbenzamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-2-fluoro-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 80671755 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-2-fluoro-N,5-dimethylbenzamide |
| SMILES | COCC(Br)CN(C)C(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C13H17BrFNO2/c1-9-4-5-12(15)11(6-9)13(17)16(2)7-10(14)8-18-3/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | SNNJNBKYVUYMOM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|