C14H20BrNO2 — CID 80671445
N-(2-bromo-3-methoxypropyl)-N,2,3-trimethylbenzamide (PubChem CID 80671445) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N,2,3-trimethylbenzamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-N,2,3-trimethylbenzamide |
|---|---|
| PubChem CID | 80671445 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N,2,3-trimethylbenzamide |
| SMILES | COCC(Br)CN(C)C(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C14H20BrNO2/c1-10-6-5-7-13(11(10)2)14(17)16(3)8-12(15)9-18-4/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | CYEBHJQWPPHPNC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|