About N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide
N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide (PubChem CID 80671004) has the molecular formula C13H18BrNO2
and a molecular weight of 300.20 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide |
| PubChem CID | 80671004 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide |
| SMILES | COCC(Br)CN(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H18BrNO2/c1-10-4-6-11(7-5-10)13(16)15(2)8-12(14)9-17-3/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | ZZFPNRDUNJVXKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide?
The IUPAC name of N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide (CID 80671004) is N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide.
What is the SMILES notation for N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide?
The canonical SMILES for N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide is COCC(Br)CN(C)C(=O)c1ccc(C)cc1.
What is the InChIKey of N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide?
The InChIKey is ZZFPNRDUNJVXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNO2/c1-10-4-6-11(7-5-10)13(16)15(2)8-12(14)9-17-3/h4-7,12H,8-9H2,1-3H3.
What are the key properties of N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide?
N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide has a molecular weight of 300.20 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-3-methoxypropyl)-N,4-dimethylbenzamide is sourced from PubChem (CID 80671004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).