C12H16BrNOS — CID 103707088
N-[(5-bromothiophen-3-yl)methyl]-2-cyclobutyl-N-methylacetamide (PubChem CID 103707088) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-cyclobutyl-N-methylacetamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-cyclobutyl-N-methylacetamide |
|---|---|
| PubChem CID | 103707088 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-cyclobutyl-N-methylacetamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)CC1CCC1 |
| InChI | InChI=1S/C12H16BrNOS/c1-14(7-10-5-11(13)16-8-10)12(15)6-9-3-2-4-9/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | WYHUPTVVTAKAPV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |