C14H17BrF3NOS — CID 78970946
N-[(5-bromothiophen-3-yl)methyl]-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 78970946) has the molecular formula C14H17BrF3NOS and a molecular weight of 384.26 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 78970946 |
| Molecular Formula | C14H17BrF3NOS |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17BrF3NOS/c1-19(7-9-5-12(15)21-8-9)13(20)10-3-2-4-11(6-10)14(16,17)18/h5,8,10-11H,2-4,6-7H2,1H3 |
| InChIKey | RBPYDHKZPUHKFB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |