C12H20F3NO2 — CID 79543923
N-(2-hydroxypropyl)-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 79543923) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79543923 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(2-hydroxypropyl)-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(O)CN(C)C(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO2/c1-8(17)7-16(2)11(18)9-4-3-5-10(6-9)12(13,14)15/h8-10,17H,3-7H2,1-2H3 |
| InChIKey | UJMOCLATMRAMEG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |