C10H16F3NO2 — CID 78887822
N-methoxy-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 78887822) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-methoxy-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 78887822 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-methoxy-N-methyl-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CON(C)C(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H16F3NO2/c1-14(16-2)9(15)7-4-3-5-8(6-7)10(11,12)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | ITNPKUYNWKBAAX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|