C8H12F3NO — CID 130860648
cis-(1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 130860648) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is cis-(1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 130860648 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | cis-(1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H12F3NO/c9-8(10,11)6-3-1-2-5(4-6)7(12)13/h5-6H,1-4H2,(H2,12,13)/t5-,6+/m0/s1 |
| InChIKey | PKRFPPYNZMXOIT-NTSWFWBYSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |