C15H17BrN2OS — CID 80700446
3-(3-aminophenyl)-N-[(5-bromothiophen-3-yl)methyl]-N-methylpropanamide (PubChem CID 80700446) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-[(5-bromothiophen-3-yl)methyl]-N-methylpropanamide.
| Compound Name | 3-(3-aminophenyl)-N-[(5-bromothiophen-3-yl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 80700446 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 3-(3-aminophenyl)-N-[(5-bromothiophen-3-yl)methyl]-N-methylpropanamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)CCc1cccc(N)c1 |
| InChI | InChI=1S/C15H17BrN2OS/c1-18(9-12-8-14(16)20-10-12)15(19)6-5-11-3-2-4-13(17)7-11/h2-4,7-8,10H,5-6,9,17H2,1H3 |
| InChIKey | XNAITSOIOSSOLG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|