C17H19FN2O — CID 61413671
3-(3-aminophenyl)-N-[(2-fluorophenyl)methyl]-N-methylpropanamide (PubChem CID 61413671) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-[(2-fluorophenyl)methyl]-N-methylpropanamide.
| Compound Name | 3-(3-aminophenyl)-N-[(2-fluorophenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 61413671 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-(3-aminophenyl)-N-[(2-fluorophenyl)methyl]-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1F)C(=O)CCc1cccc(N)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-20(12-14-6-2-3-8-16(14)18)17(21)10-9-13-5-4-7-15(19)11-13/h2-8,11H,9-10,12,19H2,1H3 |
| InChIKey | RKQDYQMWBJHZGP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|