C19H20FNO3 — CID 55397534
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 55397534) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 55397534 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H20FNO3/c1-21(13-16-9-5-6-10-17(16)20)18(22)14-24-19(23)12-11-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3 |
| InChIKey | HTCNUHLBLQHCQU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |