C18H18FNO4S — CID 55397454
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 55397454) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 55397454 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C18H18FNO4S/c1-20(11-13-5-2-3-6-14(13)19)17(22)12-24-18(23)9-8-15(21)16-7-4-10-25-16/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | NDXAPCWLNVKTKJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |