C19H21NO4S — CID 40678703
[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 40678703) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 40678703 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | Cc1ccccc1CCNC(=O)COC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C19H21NO4S/c1-14-5-2-3-6-15(14)10-11-20-18(22)13-24-19(23)9-8-16(21)17-7-4-12-25-17/h2-7,12H,8-11,13H2,1H3,(H,20,22) |
| InChIKey | MFFQOUFGEITLIE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |