C18H17F2NO4 — CID 55398107
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 55398107) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 55398107 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)COc1ccccc1F |
| InChI | InChI=1S/C18H17F2NO4/c1-21(10-13-6-2-3-7-14(13)19)17(22)11-25-18(23)12-24-16-9-5-4-8-15(16)20/h2-9H,10-12H2,1H3 |
| InChIKey | LRRGDFOELFVIAG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |