C11H15BrN2O3S — CID 47390511
ethyl 2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]acetate (PubChem CID 47390511) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is ethyl 2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]acetate |
|---|---|
| PubChem CID | 47390511 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | ethyl 2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O3S/c1-3-17-10(15)5-13-11(16)14(2)6-8-4-9(12)18-7-8/h4,7H,3,5-6H2,1-2H3,(H,13,16) |
| InChIKey | JQCQIBFXYQBCIM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |