C11H14BrN3O4S — CID 107826989
(2R)-4-amino-2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 107826989) has the molecular formula C11H14BrN3O4S and a molecular weight of 364.22 g/mol. Its IUPAC name is (2R)-4-amino-2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107826989 |
| Molecular Formula | C11H14BrN3O4S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (2R)-4-amino-2-[[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CN(Cc1csc(Br)c1)C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H14BrN3O4S/c1-15(4-6-2-8(12)20-5-6)11(19)14-7(10(17)18)3-9(13)16/h2,5,7H,3-4H2,1H3,(H2,13,16)(H,14,19)(H,17,18)/t7-/m1/s1 |
| InChIKey | WTVINOXYVBYXBX-SSDOTTSWSA-N |
| XLogP | 0.98 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |