C10H20N4O4 — CID 114005644
(2R)-4-amino-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 114005644) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2R)-4-amino-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 114005644 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2R)-4-amino-2-[[2-(dimethylamino)ethyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CN(C)CCN(C)C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H20N4O4/c1-13(2)4-5-14(3)10(18)12-7(9(16)17)6-8(11)15/h7H,4-6H2,1-3H3,(H2,11,15)(H,12,18)(H,16,17)/t7-/m1/s1 |
| InChIKey | PQXKXPLTYWGVIH-SSDOTTSWSA-N |
| XLogP | -1.48 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |