C9H15N3O6 — CID 61193149
4-amino-2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 61193149) has the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-amino-2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61193149 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-amino-2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)CN(C)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H15N3O6/c1-12(4-7(14)18-2)9(17)11-5(8(15)16)3-6(10)13/h5H,3-4H2,1-2H3,(H2,10,13)(H,11,17)(H,15,16) |
| InChIKey | IKTGZCFBLHOPGT-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |