C10H16N2O7 — CID 61192921
2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 61192921) has the molecular formula C10H16N2O7 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 61192921 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[[(2-methoxy-2-oxoethyl)-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | COC(=O)CN(C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c1-12(5-8(15)19-2)10(18)11-6(9(16)17)3-4-7(13)14/h6H,3-5H2,1-2H3,(H,11,18)(H,13,14)(H,16,17) |
| InChIKey | QOYSEWYVCUTNLA-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |