C12H22N2O6 — CID 107828313
(2R)-2-[[(2-hydroxy-2-methylpropyl)-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107828313) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2R)-2-[[(2-hydroxy-2-methylpropyl)-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[(2-hydroxy-2-methylpropyl)-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107828313 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2R)-2-[[(2-hydroxy-2-methylpropyl)-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)N(C)CC(C)(C)O)C(=O)O |
| InChI | InChI=1S/C12H22N2O6/c1-12(2,19)7-14(3)11(18)13-8(10(16)17)5-6-9(15)20-4/h8,19H,5-7H2,1-4H3,(H,13,18)(H,16,17)/t8-/m1/s1 |
| InChIKey | WWQNGULIRZZBGL-MRVPVSSYSA-N |
| XLogP | -0.19 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |