C13H25N3O5 — CID 107827833
(2R)-2-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107827833) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2R)-2-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107827833 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2R)-2-[[3-(dimethylamino)propyl-methylcarbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)N(C)CCCN(C)C)C(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-15(2)8-5-9-16(3)13(20)14-10(12(18)19)6-7-11(17)21-4/h10H,5-9H2,1-4H3,(H,14,20)(H,18,19)/t10-/m1/s1 |
| InChIKey | AIBZYQFNZUMODC-SNVBAGLBSA-N |
| XLogP | -0.01 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |