C11H19N3O6 — CID 107827068
(2R)-4-amino-2-[[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 107827068) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2R)-4-amino-2-[[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107827068 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R)-4-amino-2-[[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CCOC(=O)CN(CC)C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-3-14(6-9(16)20-4-2)11(19)13-7(10(17)18)5-8(12)15/h7H,3-6H2,1-2H3,(H2,12,15)(H,13,19)(H,17,18)/t7-/m1/s1 |
| InChIKey | OOXOIFQBHIDNSD-SSDOTTSWSA-N |
| XLogP | -1.09 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |