C11H16N2O4 — CID 47337990
ethyl 2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]acetate (PubChem CID 47337990) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl 2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 47337990 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethyl 2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(C)Cc1ccoc1 |
| InChI | InChI=1S/C11H16N2O4/c1-3-17-10(14)6-12-11(15)13(2)7-9-4-5-16-8-9/h4-5,8H,3,6-7H2,1-2H3,(H,12,15) |
| InChIKey | HBEFNUWJYLVGPO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |