C12H19NO2 — CID 110868951
N-(furan-3-ylmethyl)-N,3,3-trimethylbutanamide (PubChem CID 110868951) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N,3,3-trimethylbutanamide.
| Compound Name | N-(furan-3-ylmethyl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 110868951 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(furan-3-ylmethyl)-N,3,3-trimethylbutanamide |
| SMILES | CN(Cc1ccoc1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-12(2,3)7-11(14)13(4)8-10-5-6-15-9-10/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | OSFRWBBLZCNODW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |