C10H15NO3 — CID 61216289
2-ethoxy-N-(furan-3-ylmethyl)-N-methylacetamide (PubChem CID 61216289) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-ethoxy-N-(furan-3-ylmethyl)-N-methylacetamide.
| Compound Name | 2-ethoxy-N-(furan-3-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 61216289 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-ethoxy-N-(furan-3-ylmethyl)-N-methylacetamide |
| SMILES | CCOCC(=O)N(C)Cc1ccoc1 |
| InChI | InChI=1S/C10H15NO3/c1-3-13-8-10(12)11(2)6-9-4-5-14-7-9/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | USNBIBMOIRYTAU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |