C11H17NO2 — CID 110868913
N-(furan-3-ylmethyl)-N,3-dimethylbutanamide (PubChem CID 110868913) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N,3-dimethylbutanamide.
| Compound Name | N-(furan-3-ylmethyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 110868913 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-(furan-3-ylmethyl)-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)Cc1ccoc1 |
| InChI | InChI=1S/C11H17NO2/c1-9(2)6-11(13)12(3)7-10-4-5-14-8-10/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | SRSGKOIWHHHJGF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |