C9H9F4NO2 — CID 103733157
2,2,3,3-tetrafluoro-N-(furan-3-ylmethyl)-N-methylpropanamide (PubChem CID 103733157) has the molecular formula C9H9F4NO2 and a molecular weight of 239.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(furan-3-ylmethyl)-N-methylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(furan-3-ylmethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 103733157 |
| Molecular Formula | C9H9F4NO2 |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(furan-3-ylmethyl)-N-methylpropanamide |
| SMILES | CN(Cc1ccoc1)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4NO2/c1-14(4-6-2-3-16-5-6)8(15)9(12,13)7(10)11/h2-3,5,7H,4H2,1H3 |
| InChIKey | KKWHDSTWIVVCSZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|