C11H10ClF4NO — CID 103732007
N-[(2-chlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide (PubChem CID 103732007) has the molecular formula C11H10ClF4NO and a molecular weight of 283.65 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 103732007 |
| Molecular Formula | C11H10ClF4NO |
| Molecular Weight | 283.65 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1Cl)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10ClF4NO/c1-17(10(18)11(15,16)9(13)14)6-7-4-2-3-5-8(7)12/h2-5,9H,6H2,1H3 |
| InChIKey | HBNRBYPGRXMJRZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|