C11H9Cl2F4NO — CID 103732013
N-[(2,4-dichlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide (PubChem CID 103732013) has the molecular formula C11H9Cl2F4NO and a molecular weight of 318.10 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 103732013 |
| Molecular Formula | C11H9Cl2F4NO |
| Molecular Weight | 318.10 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
| SMILES | CN(Cc1ccc(Cl)cc1Cl)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H9Cl2F4NO/c1-18(10(19)11(16,17)9(14)15)5-6-2-3-7(12)4-8(6)13/h2-4,9H,5H2,1H3 |
| InChIKey | PWAWVYVYHXCJBL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.10 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|