C11H13Cl2NO2 — CID 62638137
2-[(2,4-dichlorophenyl)methyl-methylamino]propanoic acid (PubChem CID 62638137) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-methylamino]propanoic acid.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62638137 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO2/c1-7(11(15)16)14(2)6-8-3-4-9(12)5-10(8)13/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | KFIKYBDZPCJLHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |