C12H16Cl2N2O — CID 178067840
N-[(2,4-dichlorophenyl)methyl]-2,2-dimethylpropanehydrazide (PubChem CID 178067840) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2,2-dimethylpropanehydrazide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 178067840 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(C)C(=O)N(N)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O/c1-12(2,3)11(17)16(15)7-8-4-5-9(13)6-10(8)14/h4-6H,7,15H2,1-3H3 |
| InChIKey | YVQDNFJNWPGWCD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|