C13H17Cl2NO — CID 116571231
5-amino-1-(2,4-dichlorophenyl)-5-methylhexan-2-one (PubChem CID 116571231) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 5-amino-1-(2,4-dichlorophenyl)-5-methylhexan-2-one.
| Compound Name | 5-amino-1-(2,4-dichlorophenyl)-5-methylhexan-2-one |
|---|---|
| PubChem CID | 116571231 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-amino-1-(2,4-dichlorophenyl)-5-methylhexan-2-one |
| SMILES | CC(C)(N)CCC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO/c1-13(2,16)6-5-11(17)7-9-3-4-10(14)8-12(9)15/h3-4,8H,5-7,16H2,1-2H3 |
| InChIKey | HJKSQLMBTSBENF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |