C14H18ClFO — CID 63034237
1-(2-chloro-4-fluorophenyl)-5,5-dimethylhexan-2-one (PubChem CID 63034237) has the molecular formula C14H18ClFO and a molecular weight of 256.75 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-5,5-dimethylhexan-2-one.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 63034237 |
| Molecular Formula | C14H18ClFO |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)CCC(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H18ClFO/c1-14(2,3)7-6-12(17)8-10-4-5-11(16)9-13(10)15/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | LUBXEBYHUPWNOR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |