C10H11ClFNO — CID 126789693
2-(2-chloro-4-fluorophenyl)-N,N-dimethylacetamide (PubChem CID 126789693) has the molecular formula C10H11ClFNO and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 126789693 |
| Molecular Formula | C10H11ClFNO |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C10H11ClFNO/c1-13(2)10(14)5-7-3-4-8(12)6-9(7)11/h3-4,6H,5H2,1-2H3 |
| InChIKey | HWFMJFFAEQGGHS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |