C10H8ClFN2O — CID 126773085
2-(2-chloro-4-fluorophenyl)-N-(cyanomethyl)acetamide (PubChem CID 126773085) has the molecular formula C10H8ClFN2O and a molecular weight of 226.64 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N-(cyanomethyl)acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 126773085 |
| Molecular Formula | C10H8ClFN2O |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N-(cyanomethyl)acetamide |
| SMILES | N#CCNC(=O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C10H8ClFN2O/c11-9-6-8(12)2-1-7(9)5-10(15)14-4-3-13/h1-2,6H,4-5H2,(H,14,15) |
| InChIKey | QGNRXYLZPFGJCR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|