C15H11Cl2F2NO — CID 166226023
2-(2-chloro-4-fluorophenyl)-N-[(4-chloro-2-fluorophenyl)methyl]acetamide (PubChem CID 166226023) has the molecular formula C15H11Cl2F2NO and a molecular weight of 330.16 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N-[(4-chloro-2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N-[(4-chloro-2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 166226023 |
| Molecular Formula | C15H11Cl2F2NO |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N-[(4-chloro-2-fluorophenyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1Cl)NCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H11Cl2F2NO/c16-11-3-1-10(14(19)6-11)8-20-15(21)5-9-2-4-12(18)7-13(9)17/h1-4,6-7H,5,8H2,(H,20,21) |
| InChIKey | OQUFHBFXUSOHDO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |