C12H15ClFNO3 — CID 110482951
N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 110482951) has the molecular formula C12H15ClFNO3 and a molecular weight of 275.71 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 110482951 |
| Molecular Formula | C12H15ClFNO3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H15ClFNO3/c1-17-4-5-18-8-12(16)15-7-9-2-3-10(13)6-11(9)14/h2-3,6H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | OULKABNCXJWKJZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|