C15H12Cl2FNO — CID 166226019
N-[(4-chloro-2-fluorophenyl)methyl]-2-(4-chlorophenyl)acetamide (PubChem CID 166226019) has the molecular formula C15H12Cl2FNO and a molecular weight of 312.17 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 166226019 |
| Molecular Formula | C15H12Cl2FNO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H12Cl2FNO/c16-12-4-1-10(2-5-12)7-15(20)19-9-11-3-6-13(17)8-14(11)18/h1-6,8H,7,9H2,(H,19,20) |
| InChIKey | CEWCNKBUKJXKMP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |